C15H13F3N2O4 — CID 95986774
N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 95986774) has the molecular formula C15H13F3N2O4 and a molecular weight of 342.27 g/mol. Its IUPAC name is N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 95986774 |
| Molecular Formula | C15H13F3N2O4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-N'-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(NC[C@@H](O)c1ccoc1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O4/c16-15(17,18)10-1-3-11(4-2-10)20-14(23)13(22)19-7-12(21)9-5-6-24-8-9/h1-6,8,12,21H,7H2,(H,19,22)(H,20,23)/t12-/m1/s1 |
| InChIKey | PNXSBXKMAXTAAJ-GFCCVEGCSA-N |
| XLogP | 2.09 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|