C14H13F3N2O3 — CID 95986802
1-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 95986802) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 1-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 95986802 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-[(2S)-2-(furan-3-yl)-2-hydroxyethyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NC[C@@H](O)c1ccoc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3N2O3/c15-14(16,17)10-1-3-11(4-2-10)19-13(21)18-7-12(20)9-5-6-22-8-9/h1-6,8,12,20H,7H2,(H2,18,19,21)/t12-/m1/s1 |
| InChIKey | NWWOPLUGMIVWOC-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |