C12H13F3N2O3 — CID 51471474
N-[(2S)-2-hydroxypropyl]-N'-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 51471474) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-N'-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-N'-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 51471474 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-N'-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | C[C@H](O)CNC(=O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-7(18)6-16-10(19)11(20)17-9-4-2-8(3-5-9)12(13,14)15/h2-5,7,18H,6H2,1H3,(H,16,19)(H,17,20)/t7-/m0/s1 |
| InChIKey | HBYNLLAAEDBINY-ZETCQYMHSA-N |
| XLogP | 1.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|