C11H12F3N3O3 — CID 124652117
N-[(2R)-2-hydroxypropyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide (PubChem CID 124652117) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide |
|---|---|
| PubChem CID | 124652117 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-N'-[6-(trifluoromethyl)-3-pyridinyl]oxamide |
| SMILES | C[C@@H](O)CNC(=O)C(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H12F3N3O3/c1-6(18)4-16-9(19)10(20)17-7-2-3-8(15-5-7)11(12,13)14/h2-3,5-6,18H,4H2,1H3,(H,16,19)(H,17,20)/t6-/m1/s1 |
| InChIKey | OTKMACAUEULYCS-ZCFIWIBFSA-N |
| XLogP | 0.54 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|