C11H15N3O5S — CID 108508709
N-(2-hydroxypropyl)-N'-(4-sulfamoylphenyl)oxamide (PubChem CID 108508709) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N'-(4-sulfamoylphenyl)oxamide.
| Compound Name | N-(2-hydroxypropyl)-N'-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508709 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(2-hydroxypropyl)-N'-(4-sulfamoylphenyl)oxamide |
| SMILES | CC(O)CNC(=O)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H15N3O5S/c1-7(15)6-13-10(16)11(17)14-8-2-4-9(5-3-8)20(12,18)19/h2-5,7,15H,6H2,1H3,(H,13,16)(H,14,17)(H2,12,18,19) |
| InChIKey | CPIBOKKSIJOTLP-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|