C10H13BrN2O3S — CID 94883529
(2R)-2-bromo-N-(4-sulfamoylphenyl)butanamide (PubChem CID 94883529) has the molecular formula C10H13BrN2O3S and a molecular weight of 321.20 g/mol. Its IUPAC name is (2R)-2-bromo-N-(4-sulfamoylphenyl)butanamide.
| Compound Name | (2R)-2-bromo-N-(4-sulfamoylphenyl)butanamide |
|---|---|
| PubChem CID | 94883529 |
| Molecular Formula | C10H13BrN2O3S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | (2R)-2-bromo-N-(4-sulfamoylphenyl)butanamide |
| SMILES | CC[C@@H](Br)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H13BrN2O3S/c1-2-9(11)10(14)13-7-3-5-8(6-4-7)17(12,15)16/h3-6,9H,2H2,1H3,(H,13,14)(H2,12,15,16)/t9-/m1/s1 |
| InChIKey | DUHUSKXYADFWAD-SECBINFHSA-N |
| XLogP | 1.45 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|