C15H21BrN2O2 — CID 62855176
N-[4-(2-bromobutanoylamino)phenyl]-2,2-dimethylpropanamide (PubChem CID 62855176) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is N-[4-(2-bromobutanoylamino)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(2-bromobutanoylamino)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 62855176 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[4-(2-bromobutanoylamino)phenyl]-2,2-dimethylpropanamide |
| SMILES | CCC(Br)C(=O)Nc1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-5-12(16)13(19)17-10-6-8-11(9-7-10)18-14(20)15(2,3)4/h6-9,12H,5H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | ZKYCGFVUUIPTLG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|