C12H18N2O3S — CID 670213
(2R)-2-methyl-N-(4-sulfamoylphenyl)pentanamide (PubChem CID 670213) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is (2R)-2-methyl-N-(4-sulfamoylphenyl)pentanamide.
| Compound Name | (2R)-2-methyl-N-(4-sulfamoylphenyl)pentanamide |
|---|---|
| PubChem CID | 670213 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2R)-2-methyl-N-(4-sulfamoylphenyl)pentanamide |
| SMILES | CCC[C@@H](C)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-3-4-9(2)12(15)14-10-5-7-11(8-6-10)18(13,16)17/h5-9H,3-4H2,1-2H3,(H,14,15)(H2,13,16,17)/t9-/m1/s1 |
| InChIKey | QSFJQYWMTFBTCD-SECBINFHSA-N |
| XLogP | 1.71 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |