C12H19N3O2S2 — CID 19652353
1-pentan-2-yl-3-(4-sulfamoylphenyl)thiourea (PubChem CID 19652353) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 1-pentan-2-yl-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-pentan-2-yl-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 19652353 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-pentan-2-yl-3-(4-sulfamoylphenyl)thiourea |
| SMILES | CCCC(C)NC(=S)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-3-4-9(2)14-12(18)15-10-5-7-11(8-6-10)19(13,16)17/h5-9H,3-4H2,1-2H3,(H2,13,16,17)(H2,14,15,18) |
| InChIKey | KEXWTBGXMFRFSS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|