C12H15Cl3N4O3S2 — CID 2145598
N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide (PubChem CID 2145598) has the molecular formula C12H15Cl3N4O3S2 and a molecular weight of 433.77 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 2145598 |
| Molecular Formula | C12H15Cl3N4O3S2 |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[(4-sulfamoylphenyl)carbamothioylamino]ethyl]propanamide |
| SMILES | CCC(=O)N[C@@H](NC(=S)Nc1ccc(S(N)(=O)=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3N4O3S2/c1-2-9(20)18-10(12(13,14)15)19-11(23)17-7-3-5-8(6-4-7)24(16,21)22/h3-6,10H,2H2,1H3,(H,18,20)(H2,16,21,22)(H2,17,19,23)/t10-/m0/s1 |
| InChIKey | FHQZNPSCHRBBFD-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|