C14H17Cl3N4O2S — CID 2830638
N-[1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide (PubChem CID 2830638) has the molecular formula C14H17Cl3N4O2S and a molecular weight of 411.74 g/mol. Its IUPAC name is N-[1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide.
| Compound Name | N-[1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide |
|---|---|
| PubChem CID | 2830638 |
| Molecular Formula | C14H17Cl3N4O2S |
| Molecular Weight | 411.74 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | N-[1-[(4-acetamidophenyl)carbamothioylamino]-2,2,2-trichloroethyl]propanamide |
| SMILES | CCC(=O)NC(NC(=S)Nc1ccc(NC(C)=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H17Cl3N4O2S/c1-3-11(23)20-12(14(15,16)17)21-13(24)19-10-6-4-9(5-7-10)18-8(2)22/h4-7,12H,3H2,1-2H3,(H,18,22)(H,20,23)(H2,19,21,24) |
| InChIKey | GMKMOBPOCJIYQT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|