C16H22Cl3N5O2S — CID 35580352
N-[4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]phenyl]acetamide (PubChem CID 35580352) has the molecular formula C16H22Cl3N5O2S and a molecular weight of 454.81 g/mol. Its IUPAC name is N-[4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 35580352 |
| Molecular Formula | C16H22Cl3N5O2S |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | N-[4-[[(1R)-2,2,2-trichloro-1-(diethylcarbamoylamino)ethyl]carbamothioylamino]phenyl]acetamide |
| SMILES | CCN(CC)C(=O)N[C@H](NC(=S)Nc1ccc(NC(C)=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H22Cl3N5O2S/c1-4-24(5-2)15(26)23-13(16(17,18)19)22-14(27)21-12-8-6-11(7-9-12)20-10(3)25/h6-9,13H,4-5H2,1-3H3,(H,20,25)(H,23,26)(H2,21,22,27)/t13-/m0/s1 |
| InChIKey | AYMXTRYRAJLBOP-ZDUSSCGKSA-N |
| XLogP | 3.68 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|