C14H17Cl5N4OS — CID 35580385
1,1-diethyl-3-[(1S)-2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]urea (PubChem CID 35580385) has the molecular formula C14H17Cl5N4OS and a molecular weight of 466.65 g/mol. Its IUPAC name is 1,1-diethyl-3-[(1S)-2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]urea.
| Compound Name | 1,1-diethyl-3-[(1S)-2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]urea |
|---|---|
| PubChem CID | 35580385 |
| Molecular Formula | C14H17Cl5N4OS |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | 1,1-diethyl-3-[(1S)-2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]urea |
| SMILES | CCN(CC)C(=O)N[C@@H](NC(=S)Nc1cc(Cl)ccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H17Cl5N4OS/c1-3-23(4-2)13(24)22-11(14(17,18)19)21-12(25)20-10-7-8(15)5-6-9(10)16/h5-7,11H,3-4H2,1-2H3,(H,22,24)(H2,20,21,25)/t11-/m1/s1 |
| InChIKey | BUFIDOACUIFNQA-LLVKDONJSA-N |
| XLogP | 5.03 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|