C11H10Cl5N3OS — CID 2830080
N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 2830080) has the molecular formula C11H10Cl5N3OS and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 2830080 |
| Molecular Formula | C11H10Cl5N3OS |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 406.90 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | CC(=O)NC(NC(=S)Nc1cc(Cl)ccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl5N3OS/c1-5(20)17-9(11(14,15)16)19-10(21)18-8-4-6(12)2-3-7(8)13/h2-4,9H,1H3,(H,17,20)(H2,18,19,21) |
| InChIKey | MDSCSOBJOTYHAE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|