C23H18Cl5N3OS — CID 3562838
2,2-diphenyl-N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 3562838) has the molecular formula C23H18Cl5N3OS and a molecular weight of 561.75 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 3562838 |
| Molecular Formula | C23H18Cl5N3OS |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 558.96 |
| IUPAC Name | 2,2-diphenyl-N-[2,2,2-trichloro-1-[(2,5-dichlorophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | O=C(NC(NC(=S)Nc1cc(Cl)ccc1Cl)C(Cl)(Cl)Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18Cl5N3OS/c24-16-11-12-17(25)18(13-16)29-22(33)31-21(23(26,27)28)30-20(32)19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19,21H,(H,30,32)(H2,29,31,33) |
| InChIKey | RVGNQRBLXQZKMO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|