C16H11Cl6N3OS — CID 3958463
4-chloro-N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 3958463) has the molecular formula C16H11Cl6N3OS and a molecular weight of 506.07 g/mol. Its IUPAC name is 4-chloro-N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 3958463 |
| Molecular Formula | C16H11Cl6N3OS |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 502.88 |
| IUPAC Name | 4-chloro-N-[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | O=C(NC(NC(=S)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl6N3OS/c17-9-3-1-8(2-4-9)13(26)24-14(16(20,21)22)25-15(27)23-10-5-6-11(18)12(19)7-10/h1-7,14H,(H,24,26)(H2,23,25,27) |
| InChIKey | CFZCBDYZYZPCKG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|