C18H15Cl4N3O2S — CID 2887228
N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-chlorobenzamide (PubChem CID 2887228) has the molecular formula C18H15Cl4N3O2S and a molecular weight of 479.22 g/mol. Its IUPAC name is N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-chlorobenzamide.
| Compound Name | N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 2887228 |
| Molecular Formula | C18H15Cl4N3O2S |
| Molecular Weight | 479.22 g/mol |
| Exact Mass | 476.96 |
| IUPAC Name | N-[1-[(4-acetylphenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-chlorobenzamide |
| SMILES | CC(=O)c1ccc(NC(=S)NC(NC(=O)c2ccccc2Cl)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C18H15Cl4N3O2S/c1-10(26)11-6-8-12(9-7-11)23-17(28)25-16(18(20,21)22)24-15(27)13-4-2-3-5-14(13)19/h2-9,16H,1H3,(H,24,27)(H2,23,25,28) |
| InChIKey | OACSXWHHXRJTJB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.22 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|