C16H13Cl3IN3OS — CID 3765479
2-iodo-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]benzamide (PubChem CID 3765479) has the molecular formula C16H13Cl3IN3OS and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-iodo-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]benzamide.
| Compound Name | 2-iodo-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 3765479 |
| Molecular Formula | C16H13Cl3IN3OS |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 526.89 |
| IUPAC Name | 2-iodo-N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]benzamide |
| SMILES | O=C(NC(NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1ccccc1I |
| InChI | InChI=1S/C16H13Cl3IN3OS/c17-16(18,19)14(22-13(24)11-8-4-5-9-12(11)20)23-15(25)21-10-6-2-1-3-7-10/h1-9,14H,(H,22,24)(H2,21,23,25) |
| InChIKey | KBADFJHCXZPXKW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|