C14H15Cl3IN3O2S — CID 3772162
2-iodo-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]benzamide (PubChem CID 3772162) has the molecular formula C14H15Cl3IN3O2S and a molecular weight of 522.62 g/mol. Its IUPAC name is 2-iodo-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]benzamide.
| Compound Name | 2-iodo-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 3772162 |
| Molecular Formula | C14H15Cl3IN3O2S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 520.90 |
| IUPAC Name | 2-iodo-N-[2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]benzamide |
| SMILES | O=C(NC(NC(=S)N1CCOCC1)C(Cl)(Cl)Cl)c1ccccc1I |
| InChI | InChI=1S/C14H15Cl3IN3O2S/c15-14(16,17)12(20-13(24)21-5-7-23-8-6-21)19-11(22)9-3-1-2-4-10(9)18/h1-4,12H,5-8H2,(H,19,22)(H,20,24) |
| InChIKey | UPFOXNIZYRRBPG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|