C20H22Cl3N3OS — CID 3968266
N-[1-(azepane-1-carbothioylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide (PubChem CID 3968266) has the molecular formula C20H22Cl3N3OS and a molecular weight of 458.84 g/mol. Its IUPAC name is N-[1-(azepane-1-carbothioylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide.
| Compound Name | N-[1-(azepane-1-carbothioylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3968266 |
| Molecular Formula | C20H22Cl3N3OS |
| Molecular Weight | 458.84 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-[1-(azepane-1-carbothioylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(NC(=S)N1CCCCCC1)C(Cl)(Cl)Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H22Cl3N3OS/c21-20(22,23)18(25-19(28)26-12-5-1-2-6-13-26)24-17(27)16-11-7-9-14-8-3-4-10-15(14)16/h3-4,7-11,18H,1-2,5-6,12-13H2,(H,24,27)(H,25,28) |
| InChIKey | OWTZQGLBWQUHKH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|