C22H23Cl3N4O2S — CID 98543246
2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide (PubChem CID 98543246) has the molecular formula C22H23Cl3N4O2S and a molecular weight of 513.88 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide.
| Compound Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 98543246 |
| Molecular Formula | C22H23Cl3N4O2S |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N[C@@H](NC(=S)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H23Cl3N4O2S/c1-13-5-2-3-6-16(13)19(31)26-20(22(23,24)25)27-21(32)28-10-14-9-15(12-28)17-7-4-8-18(30)29(17)11-14/h2-8,14-15,20H,9-12H2,1H3,(H,26,31)(H,27,32)/t14-,15-,20-/m0/s1 |
| InChIKey | HRQHMEOMFFUNQM-AVYPCKFXSA-N |
| XLogP | 3.58 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|