C21H20Cl3N5O4S — CID 154808626
3-nitro-N-[2,2,2-trichloro-1-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide (PubChem CID 154808626) has the molecular formula C21H20Cl3N5O4S and a molecular weight of 544.85 g/mol. Its IUPAC name is 3-nitro-N-[2,2,2-trichloro-1-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide.
| Compound Name | 3-nitro-N-[2,2,2-trichloro-1-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 154808626 |
| Molecular Formula | C21H20Cl3N5O4S |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | 3-nitro-N-[2,2,2-trichloro-1-[[(1S,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide |
| SMILES | O=C(NC(NC(=S)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20Cl3N5O4S/c22-21(23,24)19(25-18(31)13-3-1-4-15(8-13)29(32)33)26-20(34)27-9-12-7-14(11-27)16-5-2-6-17(30)28(16)10-12/h1-6,8,12,14,19H,7,9-11H2,(H,25,31)(H,26,34)/t12-,14+,19?/m1/s1 |
| InChIKey | FVTOEQCNZVBCID-NDAWMTOCSA-N |
| XLogP | 3.18 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|