C22H23Cl3N4O3S — CID 3436528
4-methoxy-N-[2,2,2-trichloro-1-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]ethyl]benzamide (PubChem CID 3436528) has the molecular formula C22H23Cl3N4O3S and a molecular weight of 529.88 g/mol. Its IUPAC name is 4-methoxy-N-[2,2,2-trichloro-1-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2,2,2-trichloro-1-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 3436528 |
| Molecular Formula | C22H23Cl3N4O3S |
| Molecular Weight | 529.88 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 4-methoxy-N-[2,2,2-trichloro-1-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(NC(=S)N2CC3CC(C2)c2cccc(=O)n2C3)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C22H23Cl3N4O3S/c1-32-16-7-5-14(6-8-16)19(31)26-20(22(23,24)25)27-21(33)28-10-13-9-15(12-28)17-3-2-4-18(30)29(17)11-13/h2-8,13,15,20H,9-12H2,1H3,(H,26,31)(H,27,33) |
| InChIKey | OAQRMMADAQQUII-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|