C26H25Cl3N4O2S — CID 95370925
2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide (PubChem CID 95370925) has the molecular formula C26H25Cl3N4O2S and a molecular weight of 563.94 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 95370925 |
| Molecular Formula | C26H25Cl3N4O2S |
| Molecular Weight | 563.94 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide |
| SMILES | O=C(Cc1cccc2ccccc12)N[C@H](NC(=S)N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H25Cl3N4O2S/c27-26(28,29)24(30-22(34)12-18-7-3-6-17-5-1-2-8-20(17)18)31-25(36)32-13-16-11-19(15-32)21-9-4-10-23(35)33(21)14-16/h1-10,16,19,24H,11-15H2,(H,30,34)(H,31,36)/t16-,19+,24+/m0/s1 |
| InChIKey | KXYOMHDEEVWVFE-LSRZYVKLSA-N |
| XLogP | 4.35 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.94 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|