C17H19N3OS2 — CID 5304884
6-oxo-N-(thiophen-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide (PubChem CID 5304884) has the molecular formula C17H19N3OS2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 6-oxo-N-(thiophen-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide.
| Compound Name | 6-oxo-N-(thiophen-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
|---|---|
| PubChem CID | 5304884 |
| Molecular Formula | C17H19N3OS2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 6-oxo-N-(thiophen-2-ylmethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
| SMILES | O=c1cccc2n1CC1CC2CN(C(=S)NCc2cccs2)C1 |
| InChI | InChI=1S/C17H19N3OS2/c21-16-5-1-4-15-13-7-12(10-20(15)16)9-19(11-13)17(22)18-8-14-3-2-6-23-14/h1-6,12-13H,7-11H2,(H,18,22) |
| InChIKey | UXWGFRFSNXSXDG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|