C20H27N3O5S — CID 154809091
dimethyl 2-[[(9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]hexanedioate (PubChem CID 154809091) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is dimethyl 2-[[(9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]hexanedioate.
| Compound Name | dimethyl 2-[[(9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]hexanedioate |
|---|---|
| PubChem CID | 154809091 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | dimethyl 2-[[(9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]hexanedioate |
| SMILES | COC(=O)CCCC(NC(=S)N1CC2C[C@H](C1)Cn1c2cccc1=O)C(=O)OC |
| InChI | InChI=1S/C20H27N3O5S/c1-27-18(25)8-3-5-15(19(26)28-2)21-20(29)22-10-13-9-14(12-22)16-6-4-7-17(24)23(16)11-13/h4,6-7,13-15H,3,5,8-12H2,1-2H3,(H,21,29)/t13-,14?,15?/m1/s1 |
| InChIKey | MUHPWJOPCNVMAU-WLYUNCDWSA-N |
| XLogP | 1.03 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|