C21H30N4O2S — CID 124775453
(1S,9S)-N-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide (PubChem CID 124775453) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is (1S,9S)-N-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide.
| Compound Name | (1S,9S)-N-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
|---|---|
| PubChem CID | 124775453 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (1S,9S)-N-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)CNC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)C1 |
| InChI | InChI=1S/C21H30N4O2S/c1-14-6-15(2)10-23(9-14)20(27)8-22-21(28)24-11-16-7-17(13-24)18-4-3-5-19(26)25(18)12-16/h3-5,14-17H,6-13H2,1-2H3,(H,22,28)/t14-,15-,16-,17+/m1/s1 |
| InChIKey | GFFHGEJAIGYURY-VQHPVUNQSA-N |
| XLogP | 1.65 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|