C22H32N4O2S — CID 4169838
N-cyclooctyl-2-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]acetamide (PubChem CID 4169838) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-cyclooctyl-2-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]acetamide.
| Compound Name | N-cyclooctyl-2-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]acetamide |
|---|---|
| PubChem CID | 4169838 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-cyclooctyl-2-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl)amino]acetamide |
| SMILES | O=C(CNC(=S)N1CC2CC(C1)c1cccc(=O)n1C2)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H32N4O2S/c27-20(24-18-7-4-2-1-3-5-8-18)12-23-22(29)25-13-16-11-17(15-25)19-9-6-10-21(28)26(19)14-16/h6,9-10,16-18H,1-5,7-8,11-15H2,(H,23,29)(H,24,27) |
| InChIKey | DUOKIYXKWYZNDD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|