C19H20FN3OS — CID 5304879
N-[(4-fluorophenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide (PubChem CID 5304879) has the molecular formula C19H20FN3OS and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
|---|---|
| PubChem CID | 5304879 |
| Molecular Formula | C19H20FN3OS |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
| SMILES | O=c1cccc2n1CC1CC2CN(C(=S)NCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H20FN3OS/c20-16-6-4-13(5-7-16)9-21-19(25)22-10-14-8-15(12-22)17-2-1-3-18(24)23(17)11-14/h1-7,14-15H,8-12H2,(H,21,25) |
| InChIKey | WHOURFSYHKBHBU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|