C17H18N4OS — CID 154809287
(1S,9S)-6-oxo-N-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide (PubChem CID 154809287) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is (1S,9S)-6-oxo-N-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide.
| Compound Name | (1S,9S)-6-oxo-N-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
|---|---|
| PubChem CID | 154809287 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1S,9S)-6-oxo-N-pyridin-3-yl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
| SMILES | O=c1cccc2n1C[C@@H]1C[C@H]2CN(C(=S)Nc2cccnc2)C1 |
| InChI | InChI=1S/C17H18N4OS/c22-16-5-1-4-15-13-7-12(10-21(15)16)9-20(11-13)17(23)19-14-3-2-6-18-8-14/h1-6,8,12-13H,7,9-11H2,(H,19,23)/t12-,13+/m1/s1 |
| InChIKey | ZDMLSSJRDUBJQS-OLZOCXBDSA-N |
| XLogP | 2.06 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|