C20H20ClN3O3S — CID 5298947
methyl 2-chloro-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]benzoate (PubChem CID 5298947) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is methyl 2-chloro-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]benzoate |
|---|---|
| PubChem CID | 5298947 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | methyl 2-chloro-5-[[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=S)N2C[C@@H]3C[C@@H](C2)c2cccc(=O)n2C3)ccc1Cl |
| InChI | InChI=1S/C20H20ClN3O3S/c1-27-19(26)15-8-14(5-6-16(15)21)22-20(28)23-9-12-7-13(11-23)17-3-2-4-18(25)24(17)10-12/h2-6,8,12-13H,7,9-11H2,1H3,(H,22,28)/t12-,13-/m0/s1 |
| InChIKey | DPFBLCUYQQWZOC-STQMWFEESA-N |
| XLogP | 3.10 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|