C21H20Cl4N4O2S — CID 6575271
4-chloro-N-[(1S)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide (PubChem CID 6575271) has the molecular formula C21H20Cl4N4O2S and a molecular weight of 534.30 g/mol. Its IUPAC name is 4-chloro-N-[(1S)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[(1S)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 6575271 |
| Molecular Formula | C21H20Cl4N4O2S |
| Molecular Weight | 534.30 g/mol |
| Exact Mass | 532.01 |
| IUPAC Name | 4-chloro-N-[(1S)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]benzamide |
| SMILES | O=C(N[C@@H](NC(=S)N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20Cl4N4O2S/c22-15-6-4-13(5-7-15)18(31)26-19(21(23,24)25)27-20(32)28-9-12-8-14(11-28)16-2-1-3-17(30)29(16)10-12/h1-7,12,14,19H,8-11H2,(H,26,31)(H,27,32)/t12-,14+,19-/m0/s1 |
| InChIKey | HEXYBRJMLVMRGX-CFZJUORYSA-N |
| XLogP | 3.92 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|