C21H22Cl3N5O4S — CID 163139675
N-hydroxy-4-[[(1S)-2,2,2-trichloro-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]carbamoyl]benzeneamine oxide (PubChem CID 163139675) has the molecular formula C21H22Cl3N5O4S and a molecular weight of 546.86 g/mol. Its IUPAC name is N-hydroxy-4-[[(1S)-2,2,2-trichloro-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]carbamoyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[[(1S)-2,2,2-trichloro-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]carbamoyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163139675 |
| Molecular Formula | C21H22Cl3N5O4S |
| Molecular Weight | 546.86 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | N-hydroxy-4-[[(1S)-2,2,2-trichloro-1-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]carbamoyl]benzeneamine oxide |
| SMILES | O=C(N[C@@H](NC(=S)N1C[C@H]2C[C@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl)c1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C21H22Cl3N5O4S/c22-21(23,24)19(25-18(31)13-4-6-15(7-5-13)29(32)33)26-20(34)27-9-12-8-14(11-27)16-2-1-3-17(30)28(16)10-12/h1-7,12,14,19,29,32H,8-11H2,(H,25,31)(H,26,34)/t12-,14-,19+/m1/s1 |
| InChIKey | JHXXMFIZIXOCRC-TVZGQMOCSA-N |
| XLogP | 1.67 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.86 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|