C23H25Cl3N4O3S — CID 99977618
2-(2-methylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide (PubChem CID 99977618) has the molecular formula C23H25Cl3N4O3S and a molecular weight of 543.90 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide.
| Compound Name | 2-(2-methylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 99977618 |
| Molecular Formula | C23H25Cl3N4O3S |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 2-(2-methylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioyl]amino]ethyl]acetamide |
| SMILES | Cc1ccccc1OCC(=O)N[C@H](NC(=S)N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H25Cl3N4O3S/c1-14-5-2-3-7-18(14)33-13-19(31)27-21(23(24,25)26)28-22(34)29-10-15-9-16(12-29)17-6-4-8-20(32)30(17)11-15/h2-8,15-16,21H,9-13H2,1H3,(H,27,31)(H,28,34)/t15-,16+,21+/m0/s1 |
| InChIKey | OWRHQOINTGJQLW-GCKMJXCFSA-N |
| XLogP | 3.34 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|