C20H19Cl3N4O4 — CID 98481062
4-nitro-N-[(1R)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide (PubChem CID 98481062) has the molecular formula C20H19Cl3N4O4 and a molecular weight of 485.76 g/mol. Its IUPAC name is 4-nitro-N-[(1R)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide.
| Compound Name | 4-nitro-N-[(1R)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 98481062 |
| Molecular Formula | C20H19Cl3N4O4 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 4-nitro-N-[(1R)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide |
| SMILES | O=C(N[C@H](N1C[C@H]2C[C@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19Cl3N4O4/c21-20(22,23)19(24-18(29)13-4-6-15(7-5-13)27(30)31)25-9-12-8-14(11-25)16-2-1-3-17(28)26(16)10-12/h1-7,12,14,19H,8-11H2,(H,24,29)/t12-,14-,19-/m1/s1 |
| InChIKey | DKARRXHRHDLABI-BBEGDGIKSA-N |
| XLogP | 3.30 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|