C16H20Cl3N3O2 — CID 171156997
N-[2,2,2-trichloro-1-[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide (PubChem CID 171156997) has the molecular formula C16H20Cl3N3O2 and a molecular weight of 392.71 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide.
| Compound Name | N-[2,2,2-trichloro-1-[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 171156997 |
| Molecular Formula | C16H20Cl3N3O2 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(1S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide |
| SMILES | CCC(=O)NC(N1CC2C[C@@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H20Cl3N3O2/c1-2-13(23)20-15(16(17,18)19)21-7-10-6-11(9-21)12-4-3-5-14(24)22(12)8-10/h3-5,10-11,15H,2,6-9H2,1H3,(H,20,23)/t10?,11-,15?/m0/s1 |
| InChIKey | RTBAEAAQVYLPTE-VTWZXRTESA-N |
| XLogP | 2.49 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|