C18H24Cl3N3O2 — CID 98314042
2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide (PubChem CID 98314042) has the molecular formula C18H24Cl3N3O2 and a molecular weight of 420.77 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 98314042 |
| Molecular Formula | C18H24Cl3N3O2 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2,2-dimethyl-N-[(1S)-2,2,2-trichloro-1-[(1R,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)N[C@@H](N1C[C@H]2C[C@H](C1)c1cccc(=O)n1C2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H24Cl3N3O2/c1-17(2,3)16(26)22-15(18(19,20)21)23-8-11-7-12(10-23)13-5-4-6-14(25)24(13)9-11/h4-6,11-12,15H,7-10H2,1-3H3,(H,22,26)/t11-,12-,15+/m1/s1 |
| InChIKey | PPEDLGLAIQXYQN-JMSVASOKSA-N |
| XLogP | 3.13 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|