C21H22Cl3N3O2 — CID 6574642
4-methyl-N-[2,2,2-trichloro-1-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide (PubChem CID 6574642) has the molecular formula C21H22Cl3N3O2 and a molecular weight of 454.79 g/mol. Its IUPAC name is 4-methyl-N-[2,2,2-trichloro-1-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide.
| Compound Name | 4-methyl-N-[2,2,2-trichloro-1-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 6574642 |
| Molecular Formula | C21H22Cl3N3O2 |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 4-methyl-N-[2,2,2-trichloro-1-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H22Cl3N3O2/c1-13-5-7-15(8-6-13)19(29)25-20(21(22,23)24)26-10-14-9-16(12-26)17-3-2-4-18(28)27(17)11-14/h2-8,14,16,20H,9-12H2,1H3,(H,25,29)/t14-,16+,20?/m1/s1 |
| InChIKey | CYHKENGJIPADSJ-LUMABBESSA-N |
| XLogP | 3.70 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|