C14H17Cl3N2O — CID 824310
4-methyl-N-[(1R)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide (PubChem CID 824310) has the molecular formula C14H17Cl3N2O and a molecular weight of 335.66 g/mol. Its IUPAC name is 4-methyl-N-[(1R)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide.
| Compound Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 824310 |
| Molecular Formula | C14H17Cl3N2O |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-methyl-N-[(1R)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@H](N2CCCC2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H17Cl3N2O/c1-10-4-6-11(7-5-10)12(20)18-13(14(15,16)17)19-8-2-3-9-19/h4-7,13H,2-3,8-9H2,1H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | GUYBVLYAQQGDQY-CYBMUJFWSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|