C14H18Cl3N2O+ — CID 6947372
4-methyl-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl]benzamide (PubChem CID 6947372) has the molecular formula C14H18Cl3N2O+ and a molecular weight of 336.67 g/mol. Its IUPAC name is 4-methyl-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl]benzamide.
| Compound Name | 4-methyl-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 6947372 |
| Molecular Formula | C14H18Cl3N2O+ |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-methyl-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ium-1-ylethyl]benzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H]([NH+]2CCCC2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H17Cl3N2O/c1-10-4-6-11(7-5-10)12(20)18-13(14(15,16)17)19-8-2-3-9-19/h4-7,13H,2-3,8-9H2,1H3,(H,18,20)/p+1/t13-/m0/s1 |
| InChIKey | GUYBVLYAQQGDQY-ZDUSSCGKSA-O |
| XLogP | 2.10 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|