C15H19Cl3N3O3+ — CID 6966993
N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-3-nitrobenzamide (PubChem CID 6966993) has the molecular formula C15H19Cl3N3O3+ and a molecular weight of 395.69 g/mol. Its IUPAC name is N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-3-nitrobenzamide.
| Compound Name | N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 6966993 |
| Molecular Formula | C15H19Cl3N3O3+ |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-[(1R)-1-(azepan-1-ium-1-yl)-2,2,2-trichloroethyl]-3-nitrobenzamide |
| SMILES | O=C(N[C@H]([NH+]1CCCCCC1)C(Cl)(Cl)Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18Cl3N3O3/c16-15(17,18)14(20-8-3-1-2-4-9-20)19-13(22)11-6-5-7-12(10-11)21(23)24/h5-7,10,14H,1-4,8-9H2,(H,19,22)/p+1/t14-/m1/s1 |
| InChIKey | YYJKHFPKIRBVEV-CQSZACIVSA-O |
| XLogP | 2.48 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|