C14H17Cl3N4O3 — CID 34314741
3-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylpiperazin-1-yl)ethyl]benzamide (PubChem CID 34314741) has the molecular formula C14H17Cl3N4O3 and a molecular weight of 395.67 g/mol. Its IUPAC name is 3-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 3-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 34314741 |
| Molecular Formula | C14H17Cl3N4O3 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 3-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CN1CCN([C@H](NC(=O)c2cccc([N+](=O)[O-])c2)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C14H17Cl3N4O3/c1-19-5-7-20(8-6-19)13(14(15,16)17)18-12(22)10-3-2-4-11(9-10)21(23)24/h2-4,9,13H,5-8H2,1H3,(H,18,22)/t13-/m0/s1 |
| InChIKey | QHOHDXPIYGQQQP-ZDUSSCGKSA-N |
| XLogP | 2.27 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|