C15H11Cl4N3O3 — CID 3311482
3-nitro-N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]benzamide (PubChem CID 3311482) has the molecular formula C15H11Cl4N3O3 and a molecular weight of 423.08 g/mol. Its IUPAC name is 3-nitro-N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]benzamide.
| Compound Name | 3-nitro-N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 3311482 |
| Molecular Formula | C15H11Cl4N3O3 |
| Molecular Weight | 423.08 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | 3-nitro-N-[2,2,2-trichloro-1-(2-chloroanilino)ethyl]benzamide |
| SMILES | O=C(NC(Nc1ccccc1Cl)C(Cl)(Cl)Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11Cl4N3O3/c16-11-6-1-2-7-12(11)20-14(15(17,18)19)21-13(23)9-4-3-5-10(8-9)22(24)25/h1-8,14,20H,(H,21,23) |
| InChIKey | GOZVLRUESXBNRV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|