C15H9Cl7N2O — CID 134122688
3,4-dichloro-N-[2,2,2-trichloro-1-(2,3-dichloroanilino)ethyl]benzamide (PubChem CID 134122688) has the molecular formula C15H9Cl7N2O and a molecular weight of 481.42 g/mol. Its IUPAC name is 3,4-dichloro-N-[2,2,2-trichloro-1-(2,3-dichloroanilino)ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2,2,2-trichloro-1-(2,3-dichloroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 134122688 |
| Molecular Formula | C15H9Cl7N2O |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 477.85 |
| IUPAC Name | 3,4-dichloro-N-[2,2,2-trichloro-1-(2,3-dichloroanilino)ethyl]benzamide |
| SMILES | O=C(NC(Nc1cccc(Cl)c1Cl)C(Cl)(Cl)Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl7N2O/c16-8-5-4-7(6-10(8)18)13(25)24-14(15(20,21)22)23-11-3-1-2-9(17)12(11)19/h1-6,14,23H,(H,24,25) |
| InChIKey | AJCJKIOESWRURD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|