C10H7Cl5N2O2 — CID 134118036
3,4-dichloro-N-(2,2,2-trichloro-1-formamidoethyl)benzamide (PubChem CID 134118036) has the molecular formula C10H7Cl5N2O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is 3,4-dichloro-N-(2,2,2-trichloro-1-formamidoethyl)benzamide.
| Compound Name | 3,4-dichloro-N-(2,2,2-trichloro-1-formamidoethyl)benzamide |
|---|---|
| PubChem CID | 134118036 |
| Molecular Formula | C10H7Cl5N2O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 3,4-dichloro-N-(2,2,2-trichloro-1-formamidoethyl)benzamide |
| SMILES | O=CNC(NC(=O)c1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H7Cl5N2O2/c11-6-2-1-5(3-7(6)12)8(19)17-9(16-4-18)10(13,14)15/h1-4,9H,(H,16,18)(H,17,19) |
| InChIKey | KKCZXGPAXKLTAG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|