C11H9Cl2NO4 — CID 152540759
2-[(3,4-dichlorobenzoyl)amino]-4-oxobutanoic acid (PubChem CID 152540759) has the molecular formula C11H9Cl2NO4 and a molecular weight of 290.10 g/mol. Its IUPAC name is 2-[(3,4-dichlorobenzoyl)amino]-4-oxobutanoic acid.
| Compound Name | 2-[(3,4-dichlorobenzoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 152540759 |
| Molecular Formula | C11H9Cl2NO4 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-[(3,4-dichlorobenzoyl)amino]-4-oxobutanoic acid |
| SMILES | O=CCC(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H9Cl2NO4/c12-7-2-1-6(5-8(7)13)10(16)14-9(3-4-15)11(17)18/h1-2,4-5,9H,3H2,(H,14,16)(H,17,18) |
| InChIKey | YLMOOKSPPGZMTQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|