C15H9Cl4F3N2O — CID 134122685
3,4-dichloro-N-[1-(3,4-dichloroanilino)-2,2,2-trifluoroethyl]benzamide (PubChem CID 134122685) has the molecular formula C15H9Cl4F3N2O and a molecular weight of 432.06 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-(3,4-dichloroanilino)-2,2,2-trifluoroethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[1-(3,4-dichloroanilino)-2,2,2-trifluoroethyl]benzamide |
|---|---|
| PubChem CID | 134122685 |
| Molecular Formula | C15H9Cl4F3N2O |
| Molecular Weight | 432.06 g/mol |
| Exact Mass | 429.94 |
| IUPAC Name | 3,4-dichloro-N-[1-(3,4-dichloroanilino)-2,2,2-trifluoroethyl]benzamide |
| SMILES | O=C(NC(Nc1ccc(Cl)c(Cl)c1)C(F)(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl4F3N2O/c16-9-3-1-7(5-11(9)18)13(25)24-14(15(20,21)22)23-8-2-4-10(17)12(19)6-8/h1-6,14,23H,(H,24,25) |
| InChIKey | SSNYZYCNYFNJLU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.06 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|