C14H8Cl2F3NO2 — CID 18267923
N-(3,4-dichlorophenyl)-4-(trifluoromethoxy)benzamide (PubChem CID 18267923) has the molecular formula C14H8Cl2F3NO2 and a molecular weight of 350.12 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 18267923 |
| Molecular Formula | C14H8Cl2F3NO2 |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H8Cl2F3NO2/c15-11-6-3-9(7-12(11)16)20-13(21)8-1-4-10(5-2-8)22-14(17,18)19/h1-7H,(H,20,21) |
| InChIKey | YKBGSNUULKLUET-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |