C13H7Cl2F3N2O2 — CID 26289080
2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyridine-4-carboxamide (PubChem CID 26289080) has the molecular formula C13H7Cl2F3N2O2 and a molecular weight of 351.11 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 26289080 |
| Molecular Formula | C13H7Cl2F3N2O2 |
| Molecular Weight | 351.11 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 2,6-dichloro-N-[4-(trifluoromethoxy)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H7Cl2F3N2O2/c14-10-5-7(6-11(15)20-10)12(21)19-8-1-3-9(4-2-8)22-13(16,17)18/h1-6H,(H,19,21) |
| InChIKey | KMEMGCQCEKUAJT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.11 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|