C14H10Cl2F2N2O3 — CID 166563677
2-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-6-methoxypyridine-4-carboxamide (PubChem CID 166563677) has the molecular formula C14H10Cl2F2N2O3 and a molecular weight of 363.15 g/mol. Its IUPAC name is 2-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-6-methoxypyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-6-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 166563677 |
| Molecular Formula | C14H10Cl2F2N2O3 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2-chloro-N-[4-[chloro(difluoro)methoxy]phenyl]-6-methoxypyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cc(Cl)n1 |
| InChI | InChI=1S/C14H10Cl2F2N2O3/c1-22-12-7-8(6-11(15)20-12)13(21)19-9-2-4-10(5-3-9)23-14(16,17)18/h2-7H,1H3,(H,19,21) |
| InChIKey | BPWRZPQTAYIOIX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|